C25H22F2N4O — CID 45376144
N-(cyclopropylmethyl)-N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-(6-fluoro-3-pyridinyl)pyridine-2-carboxamide (PubChem CID 45376144) has the molecular formula C25H22F2N4O and a molecular weight of 432.47 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-(6-fluoro-3-pyridinyl)pyridine-2-carboxamide.
| Compound Name | N-(cyclopropylmethyl)-N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-(6-fluoro-3-pyridinyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 45376144 |
| Molecular Formula | C25H22F2N4O |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | N-(cyclopropylmethyl)-N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-(6-fluoro-3-pyridinyl)pyridine-2-carboxamide |
| SMILES | O=C(c1ncccc1-c1ccc(F)nc1)N(CCc1c[nH]c2ccc(F)cc12)CC1CC1 |
| InChI | InChI=1S/C25H22F2N4O/c26-19-6-7-22-21(12-19)18(13-29-22)9-11-31(15-16-3-4-16)25(32)24-20(2-1-10-28-24)17-5-8-23(27)30-14-17/h1-2,5-8,10,12-14,16,29H,3-4,9,11,15H2 |
| InChIKey | BIWRSFMFYDUSJV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|