C22H17F3N2O2 — CID 67973468
4-(furan-2-yl)-N-[2-[5-(trifluoromethyl)-1H-indol-3-yl]ethyl]benzamide (PubChem CID 67973468) has the molecular formula C22H17F3N2O2 and a molecular weight of 398.38 g/mol. Its IUPAC name is 4-(furan-2-yl)-N-[2-[5-(trifluoromethyl)-1H-indol-3-yl]ethyl]benzamide.
| Compound Name | 4-(furan-2-yl)-N-[2-[5-(trifluoromethyl)-1H-indol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 67973468 |
| Molecular Formula | C22H17F3N2O2 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 4-(furan-2-yl)-N-[2-[5-(trifluoromethyl)-1H-indol-3-yl]ethyl]benzamide |
| SMILES | O=C(NCCc1c[nH]c2ccc(C(F)(F)F)cc12)c1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C22H17F3N2O2/c23-22(24,25)17-7-8-19-18(12-17)16(13-27-19)9-10-26-21(28)15-5-3-14(4-6-15)20-2-1-11-29-20/h1-8,11-13,27H,9-10H2,(H,26,28) |
| InChIKey | DKDAXDAKNIMOFU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |