C15H14FN3O2 — CID 92600014
5-fluoro-3-methyl-N-[(1-methylimidazol-2-yl)methyl]-1-benzofuran-2-carboxamide (PubChem CID 92600014) has the molecular formula C15H14FN3O2 and a molecular weight of 287.29 g/mol. Its IUPAC name is 5-fluoro-3-methyl-N-[(1-methylimidazol-2-yl)methyl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-fluoro-3-methyl-N-[(1-methylimidazol-2-yl)methyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 92600014 |
| Molecular Formula | C15H14FN3O2 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 5-fluoro-3-methyl-N-[(1-methylimidazol-2-yl)methyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCc2nccn2C)oc2ccc(F)cc12 |
| InChI | InChI=1S/C15H14FN3O2/c1-9-11-7-10(16)3-4-12(11)21-14(9)15(20)18-8-13-17-5-6-19(13)2/h3-7H,8H2,1-2H3,(H,18,20) |
| InChIKey | BCFCOJDOCAFZHU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |