C12H12FN3O2 — CID 113304577
4-fluoro-2-hydroxy-N-[(1-methylimidazol-2-yl)methyl]benzamide (PubChem CID 113304577) has the molecular formula C12H12FN3O2 and a molecular weight of 249.25 g/mol. Its IUPAC name is 4-fluoro-2-hydroxy-N-[(1-methylimidazol-2-yl)methyl]benzamide.
| Compound Name | 4-fluoro-2-hydroxy-N-[(1-methylimidazol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 113304577 |
| Molecular Formula | C12H12FN3O2 |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 4-fluoro-2-hydroxy-N-[(1-methylimidazol-2-yl)methyl]benzamide |
| SMILES | Cn1ccnc1CNC(=O)c1ccc(F)cc1O |
| InChI | InChI=1S/C12H12FN3O2/c1-16-5-4-14-11(16)7-15-12(18)9-3-2-8(13)6-10(9)17/h2-6,17H,7H2,1H3,(H,15,18) |
| InChIKey | OQDJNBYVFXZBKB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |