C20H20BrFN2O4S — CID 4246541
N-(4-bromo-2-fluorophenyl)-5-(diethylsulfamoyl)-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 4246541) has the molecular formula C20H20BrFN2O4S and a molecular weight of 483.36 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-5-(diethylsulfamoyl)-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-5-(diethylsulfamoyl)-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 4246541 |
| Molecular Formula | C20H20BrFN2O4S |
| Molecular Weight | 483.36 g/mol |
| Exact Mass | 482.03 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-5-(diethylsulfamoyl)-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2oc(C(=O)Nc3ccc(Br)cc3F)c(C)c2c1 |
| InChI | InChI=1S/C20H20BrFN2O4S/c1-4-24(5-2)29(26,27)14-7-9-18-15(11-14)12(3)19(28-18)20(25)23-17-8-6-13(21)10-16(17)22/h6-11H,4-5H2,1-3H3,(H,23,25) |
| InChIKey | WBSJBKQUCWBFIH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.36 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |