C22H24BrN3O2 — CID 39727003
5-bromo-3-methyl-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-1-benzofuran-2-carboxamide (PubChem CID 39727003) has the molecular formula C22H24BrN3O2 and a molecular weight of 442.36 g/mol. Its IUPAC name is 5-bromo-3-methyl-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-3-methyl-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 39727003 |
| Molecular Formula | C22H24BrN3O2 |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 5-bromo-3-methyl-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2oc3ccc(Br)cc3c2C)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C22H24BrN3O2/c1-14-12-17(5-6-19(14)26-10-8-25(3)9-11-26)24-22(27)21-15(2)18-13-16(23)4-7-20(18)28-21/h4-7,12-13H,8-11H2,1-3H3,(H,24,27) |
| InChIKey | IRVRDUYTDBREDH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|