C22H17BrN4O2 — CID 60622514
6-bromo-2-methyl-N-[2-oxo-2-(quinolin-8-ylamino)ethyl]quinoline-4-carboxamide (PubChem CID 60622514) has the molecular formula C22H17BrN4O2 and a molecular weight of 449.31 g/mol. Its IUPAC name is 6-bromo-2-methyl-N-[2-oxo-2-(quinolin-8-ylamino)ethyl]quinoline-4-carboxamide.
| Compound Name | 6-bromo-2-methyl-N-[2-oxo-2-(quinolin-8-ylamino)ethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 60622514 |
| Molecular Formula | C22H17BrN4O2 |
| Molecular Weight | 449.31 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 6-bromo-2-methyl-N-[2-oxo-2-(quinolin-8-ylamino)ethyl]quinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCC(=O)Nc2cccc3cccnc23)c2cc(Br)ccc2n1 |
| InChI | InChI=1S/C22H17BrN4O2/c1-13-10-17(16-11-15(23)7-8-18(16)26-13)22(29)25-12-20(28)27-19-6-2-4-14-5-3-9-24-21(14)19/h2-11H,12H2,1H3,(H,25,29)(H,27,28) |
| InChIKey | IRKUGQMIAKRNPI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.31 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |