C20H19N3O2 — CID 24681832
N-[2-(2,3-dimethylanilino)-2-oxoethyl]quinoline-8-carboxamide (PubChem CID 24681832) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is N-[2-(2,3-dimethylanilino)-2-oxoethyl]quinoline-8-carboxamide.
| Compound Name | N-[2-(2,3-dimethylanilino)-2-oxoethyl]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 24681832 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-[2-(2,3-dimethylanilino)-2-oxoethyl]quinoline-8-carboxamide |
| SMILES | Cc1cccc(NC(=O)CNC(=O)c2cccc3cccnc23)c1C |
| InChI | InChI=1S/C20H19N3O2/c1-13-6-3-10-17(14(13)2)23-18(24)12-22-20(25)16-9-4-7-15-8-5-11-21-19(15)16/h3-11H,12H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | VRIMTAYPJKNSER-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |