C16H14ClNO3S — CID 111441608
5-chloro-N-(2-hydroxy-2-thiophen-3-ylethyl)-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 111441608) has the molecular formula C16H14ClNO3S and a molecular weight of 335.81 g/mol. Its IUPAC name is 5-chloro-N-(2-hydroxy-2-thiophen-3-ylethyl)-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-(2-hydroxy-2-thiophen-3-ylethyl)-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 111441608 |
| Molecular Formula | C16H14ClNO3S |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 5-chloro-N-(2-hydroxy-2-thiophen-3-ylethyl)-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCC(O)c2ccsc2)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C16H14ClNO3S/c1-9-12-6-11(17)2-3-14(12)21-15(9)16(20)18-7-13(19)10-4-5-22-8-10/h2-6,8,13,19H,7H2,1H3,(H,18,20) |
| InChIKey | RGDHUSZWVKSKRB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |