C16H19N3O3 — CID 87388197
N-[1-[3-(hydroxycarbamoyl)phenyl]ethyl]-3,5-dimethyl-1H-pyrrole-2-carboxamide (PubChem CID 87388197) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-[1-[3-(hydroxycarbamoyl)phenyl]ethyl]-3,5-dimethyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-[1-[3-(hydroxycarbamoyl)phenyl]ethyl]-3,5-dimethyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 87388197 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-[1-[3-(hydroxycarbamoyl)phenyl]ethyl]-3,5-dimethyl-1H-pyrrole-2-carboxamide |
| SMILES | Cc1cc(C)c(C(=O)NC(C)c2cccc(C(=O)NO)c2)[nH]1 |
| InChI | InChI=1S/C16H19N3O3/c1-9-7-10(2)17-14(9)16(21)18-11(3)12-5-4-6-13(8-12)15(20)19-22/h4-8,11,17,22H,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | CVSWHEDIXXVHJN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|