C18H24N4O3 — CID 159508218
N-[1-[3-(hydroxycarbamoyl)phenyl]ethyl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide;methane (PubChem CID 159508218) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is N-[1-[3-(hydroxycarbamoyl)phenyl]ethyl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide;methane.
| Compound Name | N-[1-[3-(hydroxycarbamoyl)phenyl]ethyl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide;methane |
|---|---|
| PubChem CID | 159508218 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N-[1-[3-(hydroxycarbamoyl)phenyl]ethyl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide;methane |
| SMILES | C.CC(NC(=O)c1n[nH]c2c1CCCC2)c1cccc(C(=O)NO)c1 |
| InChI | InChI=1S/C17H20N4O3.CH4/c1-10(11-5-4-6-12(9-11)16(22)21-24)18-17(23)15-13-7-2-3-8-14(13)19-20-15;/h4-6,9-10,24H,2-3,7-8H2,1H3,(H,18,23)(H,19,20)(H,21,22);1H4 |
| InChIKey | MAGOZDTYNMVXTN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|