C17H20N4O — CID 3455772
N-(1-phenylpropylideneamino)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide (PubChem CID 3455772) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is N-(1-phenylpropylideneamino)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide.
| Compound Name | N-(1-phenylpropylideneamino)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 3455772 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | N-(1-phenylpropylideneamino)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
| SMILES | CCC(=NNC(=O)c1n[nH]c2c1CCCC2)c1ccccc1 |
| InChI | InChI=1S/C17H20N4O/c1-2-14(12-8-4-3-5-9-12)18-21-17(22)16-13-10-6-7-11-15(13)19-20-16/h3-5,8-9H,2,6-7,10-11H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | WLORXXPLRWKFBY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|