C17H18N4O — CID 6142473
N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide (PubChem CID 6142473) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide.
| Compound Name | N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 6142473 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
| SMILES | O=C(N/N=C\C=C\c1ccccc1)c1n[nH]c2c1CCCC2 |
| InChI | InChI=1S/C17H18N4O/c22-17(16-14-10-4-5-11-15(14)19-20-16)21-18-12-6-9-13-7-2-1-3-8-13/h1-3,6-9,12H,4-5,10-11H2,(H,19,20)(H,21,22)/b9-6+,18-12- |
| InChIKey | FEVMTKOCFFTEGJ-YKYHQJSKSA-N |
| XLogP | 2.72 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|