C19H25N3O3 — CID 124721703
N-[(2S,4R)-1,4-dihydroxy-4-phenylbutan-2-yl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxamide (PubChem CID 124721703) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[(2S,4R)-1,4-dihydroxy-4-phenylbutan-2-yl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxamide.
| Compound Name | N-[(2S,4R)-1,4-dihydroxy-4-phenylbutan-2-yl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 124721703 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-[(2S,4R)-1,4-dihydroxy-4-phenylbutan-2-yl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxamide |
| SMILES | O=C(N[C@H](CO)C[C@@H](O)c1ccccc1)c1n[nH]c2c1CCCCC2 |
| InChI | InChI=1S/C19H25N3O3/c23-12-14(11-17(24)13-7-3-1-4-8-13)20-19(25)18-15-9-5-2-6-10-16(15)21-22-18/h1,3-4,7-8,14,17,23-24H,2,5-6,9-12H2,(H,20,25)(H,21,22)/t14-,17+/m0/s1 |
| InChIKey | AHJRSSVMWURBGQ-WMLDXEAASA-N |
| XLogP | 1.89 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |