C15H16ClNO3S — CID 122158938
5-chloro-N-(1,4-dihydroxy-4-phenylbutan-2-yl)thiophene-2-carboxamide (PubChem CID 122158938) has the molecular formula C15H16ClNO3S and a molecular weight of 325.82 g/mol. Its IUPAC name is 5-chloro-N-(1,4-dihydroxy-4-phenylbutan-2-yl)thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-(1,4-dihydroxy-4-phenylbutan-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 122158938 |
| Molecular Formula | C15H16ClNO3S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 5-chloro-N-(1,4-dihydroxy-4-phenylbutan-2-yl)thiophene-2-carboxamide |
| SMILES | O=C(NC(CO)CC(O)c1ccccc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H16ClNO3S/c16-14-7-6-13(21-14)15(20)17-11(9-18)8-12(19)10-4-2-1-3-5-10/h1-7,11-12,18-19H,8-9H2,(H,17,20) |
| InChIKey | LXXKADDSYJDGQA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |