C17H19F2N3O3S — CID 55541921
1-[(2,4-difluorophenyl)methyl]-1-methyl-3-[1-(3-sulfamoylphenyl)ethyl]urea (PubChem CID 55541921) has the molecular formula C17H19F2N3O3S and a molecular weight of 383.42 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-1-methyl-3-[1-(3-sulfamoylphenyl)ethyl]urea.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]-1-methyl-3-[1-(3-sulfamoylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 55541921 |
| Molecular Formula | C17H19F2N3O3S |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]-1-methyl-3-[1-(3-sulfamoylphenyl)ethyl]urea |
| SMILES | CC(NC(=O)N(C)Cc1ccc(F)cc1F)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C17H19F2N3O3S/c1-11(12-4-3-5-15(8-12)26(20,24)25)21-17(23)22(2)10-13-6-7-14(18)9-16(13)19/h3-9,11H,10H2,1-2H3,(H,21,23)(H2,20,24,25) |
| InChIKey | ZHVJJFGSKZQPIN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |