C18H34N2O2 — CID 111331881
N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(1-hydroxycyclohexyl)acetamide (PubChem CID 111331881) has the molecular formula C18H34N2O2 and a molecular weight of 310.48 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(1-hydroxycyclohexyl)acetamide.
| Compound Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(1-hydroxycyclohexyl)acetamide |
|---|---|
| PubChem CID | 111331881 |
| Molecular Formula | C18H34N2O2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.26 |
| IUPAC Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(1-hydroxycyclohexyl)acetamide |
| SMILES | CC1CC(C)CN(CCCNC(=O)CC2(O)CCCCC2)C1 |
| InChI | InChI=1S/C18H34N2O2/c1-15-11-16(2)14-20(13-15)10-6-9-19-17(21)12-18(22)7-4-3-5-8-18/h15-16,22H,3-14H2,1-2H3,(H,19,21) |
| InChIKey | IRWQHPVISOPUGJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|