C14H18N2O5 — CID 108514776
N'-(4-acetylphenyl)-N-[2-(2-hydroxyethoxy)ethyl]oxamide (PubChem CID 108514776) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is N'-(4-acetylphenyl)-N-[2-(2-hydroxyethoxy)ethyl]oxamide.
| Compound Name | N'-(4-acetylphenyl)-N-[2-(2-hydroxyethoxy)ethyl]oxamide |
|---|---|
| PubChem CID | 108514776 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N'-(4-acetylphenyl)-N-[2-(2-hydroxyethoxy)ethyl]oxamide |
| SMILES | CC(=O)c1ccc(NC(=O)C(=O)NCCOCCO)cc1 |
| InChI | InChI=1S/C14H18N2O5/c1-10(18)11-2-4-12(5-3-11)16-14(20)13(19)15-6-8-21-9-7-17/h2-5,17H,6-9H2,1H3,(H,15,19)(H,16,20) |
| InChIKey | KFEDBWQORJHSHG-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|