C19H19ClN4O6 — CID 55405046
[2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-(propan-2-ylcarbamoylamino)benzoate (PubChem CID 55405046) has the molecular formula C19H19ClN4O6 and a molecular weight of 434.84 g/mol. Its IUPAC name is [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-(propan-2-ylcarbamoylamino)benzoate.
| Compound Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-(propan-2-ylcarbamoylamino)benzoate |
|---|---|
| PubChem CID | 55405046 |
| Molecular Formula | C19H19ClN4O6 |
| Molecular Weight | 434.84 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-(propan-2-ylcarbamoylamino)benzoate |
| SMILES | CC(C)NC(=O)Nc1ccccc1C(=O)OCC(=O)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19ClN4O6/c1-11(2)21-19(27)23-14-6-4-3-5-13(14)18(26)30-10-17(25)22-15-8-7-12(20)9-16(15)24(28)29/h3-9,11H,10H2,1-2H3,(H,22,25)(H2,21,23,27) |
| InChIKey | NXZPMNULVUNTGN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.84 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|