C56H90O8 — CID 139855018
tetrakis-decyl 5-phenylbenzene-1,2,3,4-tetracarboxylate (PubChem CID 139855018) has the molecular formula C56H90O8 and a molecular weight of 891.33 g/mol. Its IUPAC name is tetrakis-decyl 5-phenylbenzene-1,2,3,4-tetracarboxylate.
| Compound Name | tetrakis-decyl 5-phenylbenzene-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 139855018 |
| Molecular Formula | C56H90O8 |
| Molecular Weight | 891.33 g/mol |
| Exact Mass | 890.66 |
| IUPAC Name | tetrakis-decyl 5-phenylbenzene-1,2,3,4-tetracarboxylate |
| SMILES | CCCCCCCCCCOC(=O)c1cc(-c2ccccc2)c(C(=O)OCCCCCCCCCC)c(C(=O)OCCCCCCCCCC)c1C(=O)OCCCCCCCCCC |
| InChI | InChI=1S/C56H90O8/c1-5-9-13-17-21-25-29-36-42-61-53(57)49-46-48(47-40-34-33-35-41-47)50(54(58)62-43-37-30-26-22-18-14-10-6-2)52(56(60)64-45-39-32-28-24-20-16-12-8-4)51(49)55(59)63-44-38-31-27-23-19-15-11-7-3/h33-35,40-41,46H,5-32,36-39,42-45H2,1-4H3 |
| InChIKey | UCNFSAVRANBKEV-UHFFFAOYSA-N |
| XLogP | 16.54 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.33 |
| LogP ≤ 5 | 16.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|