C22H32O7 — CID 69294837
2,3-dihydroxypropyl 3-[2-(2-ethylhexanoyl)phenyl]-2,3-dimethoxyprop-2-enoate (PubChem CID 69294837) has the molecular formula C22H32O7 and a molecular weight of 408.49 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 3-[2-(2-ethylhexanoyl)phenyl]-2,3-dimethoxyprop-2-enoate.
| Compound Name | 2,3-dihydroxypropyl 3-[2-(2-ethylhexanoyl)phenyl]-2,3-dimethoxyprop-2-enoate |
|---|---|
| PubChem CID | 69294837 |
| Molecular Formula | C22H32O7 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 2,3-dihydroxypropyl 3-[2-(2-ethylhexanoyl)phenyl]-2,3-dimethoxyprop-2-enoate |
| SMILES | CCCCC(CC)C(=O)c1ccccc1C(OC)=C(OC)C(=O)OCC(O)CO |
| InChI | InChI=1S/C22H32O7/c1-5-7-10-15(6-2)19(25)17-11-8-9-12-18(17)20(27-3)21(28-4)22(26)29-14-16(24)13-23/h8-9,11-12,15-16,23-24H,5-7,10,13-14H2,1-4H3 |
| InChIKey | LMIQHDUBVONVNC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|