C31H42O10 — CID 66660641
2,3-dihydroxypropyl 2-ethylhexanoate;bis(3-(4-methoxyphenyl)prop-2-enoic acid) (PubChem CID 66660641) has the molecular formula C31H42O10 and a molecular weight of 574.67 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-ethylhexanoate;bis(3-(4-methoxyphenyl)prop-2-enoic acid).
| Compound Name | 2,3-dihydroxypropyl 2-ethylhexanoate;bis(3-(4-methoxyphenyl)prop-2-enoic acid) |
|---|---|
| PubChem CID | 66660641 |
| Molecular Formula | C31H42O10 |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | 2,3-dihydroxypropyl 2-ethylhexanoate;bis(3-(4-methoxyphenyl)prop-2-enoic acid) |
| SMILES | CCCCC(CC)C(=O)OCC(O)CO.COc1ccc(C=CC(=O)O)cc1.COc1ccc(C=CC(=O)O)cc1 |
| InChI | InChI=1S/C11H22O4.2C10H10O3/c1-3-5-6-9(4-2)11(14)15-8-10(13)7-12;2*1-13-9-5-2-8(3-6-9)4-7-10(11)12/h9-10,12-13H,3-8H2,1-2H3;2*2-7H,1H3,(H,11,12) |
| InChIKey | AFDLXJOBOCFHAE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|