C22H34O8 — CID 66822865
2-butyl-6,7-dihydroxyheptanoic acid;2,3-dimethoxy-3-phenylprop-2-enoic acid (PubChem CID 66822865) has the molecular formula C22H34O8 and a molecular weight of 426.51 g/mol. Its IUPAC name is 2-butyl-6,7-dihydroxyheptanoic acid;2,3-dimethoxy-3-phenylprop-2-enoic acid.
| Compound Name | 2-butyl-6,7-dihydroxyheptanoic acid;2,3-dimethoxy-3-phenylprop-2-enoic acid |
|---|---|
| PubChem CID | 66822865 |
| Molecular Formula | C22H34O8 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 2-butyl-6,7-dihydroxyheptanoic acid;2,3-dimethoxy-3-phenylprop-2-enoic acid |
| SMILES | CCCCC(CCCC(O)CO)C(=O)O.COC(C(=O)O)=C(OC)c1ccccc1 |
| InChI | InChI=1S/C11H12O4.C11H22O4/c1-14-9(10(15-2)11(12)13)8-6-4-3-5-7-8;1-2-3-5-9(11(14)15)6-4-7-10(13)8-12/h3-7H,1-2H3,(H,12,13);9-10,12-13H,2-8H2,1H3,(H,14,15) |
| InChIKey | SSDMCDVVYNPTBL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|