C32H28CuN2O2S2 — CID 50908659
copper;benzene-1,2-dithiolate;4-[[(5E)-3-[N-(4-hydroxyphenyl)-C-methylcarbonimidoyl]-6-phenylhexa-3,5-dien-2-ylidene]amino]phenol (PubChem CID 50908659) has the molecular formula C32H28CuN2O2S2 and a molecular weight of 600.27 g/mol. Its IUPAC name is copper;benzene-1,2-dithiolate;4-[[(5E)-3-[N-(4-hydroxyphenyl)-C-methylcarbonimidoyl]-6-phenylhexa-3,5-dien-2-ylidene]amino]phenol.
| Compound Name | copper;benzene-1,2-dithiolate;4-[[(5E)-3-[N-(4-hydroxyphenyl)-C-methylcarbonimidoyl]-6-phenylhexa-3,5-dien-2-ylidene]amino]phenol |
|---|---|
| PubChem CID | 50908659 |
| Molecular Formula | C32H28CuN2O2S2 |
| Molecular Weight | 600.27 g/mol |
| Exact Mass | 599.09 |
| IUPAC Name | copper;benzene-1,2-dithiolate;4-[[(5E)-3-[N-(4-hydroxyphenyl)-C-methylcarbonimidoyl]-6-phenylhexa-3,5-dien-2-ylidene]amino]phenol |
| SMILES | C/C(=N\c1ccc(O)cc1)C(=C/C=C/c1ccccc1)/C(C)=N/c1ccc(O)cc1.[Cu+2].[S-]c1ccccc1[S-] |
| InChI | InChI=1S/C26H24N2O2.C6H6S2.Cu/c1-19(27-22-11-15-24(29)16-12-22)26(10-6-9-21-7-4-3-5-8-21)20(2)28-23-13-17-25(30)18-14-23;7-5-3-1-2-4-6(5)8;/h3-18,29-30H,1-2H3;1-4,7-8H;/q;;+2/p-2/b9-6+,27-19+,28-20+;; |
| InChIKey | ISJBLXXATLIBDD-NCYANYKZSA-L |
| XLogP | 8.12 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.27 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|