C22H30P2+2 — CID 173265092
trimethyl-[4-[4-(4-trimethylphosphaniumylphenyl)buta-1,3-dienyl]phenyl]phosphanium (PubChem CID 173265092) has the molecular formula C22H30P2+2 and a molecular weight of 356.43 g/mol. Its IUPAC name is trimethyl-[4-[4-(4-trimethylphosphaniumylphenyl)buta-1,3-dienyl]phenyl]phosphanium.
| Compound Name | trimethyl-[4-[4-(4-trimethylphosphaniumylphenyl)buta-1,3-dienyl]phenyl]phosphanium |
|---|---|
| PubChem CID | 173265092 |
| Molecular Formula | C22H30P2+2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | trimethyl-[4-[4-(4-trimethylphosphaniumylphenyl)buta-1,3-dienyl]phenyl]phosphanium |
| SMILES | C[P+](C)(C)c1ccc(C=CC=Cc2ccc([P+](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H30P2/c1-23(2,3)21-15-11-19(12-16-21)9-7-8-10-20-13-17-22(18-14-20)24(4,5)6/h7-18H,1-6H3/q+2 |
| InChIKey | ULWYTOTUPIQJFY-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|