C20H20O4 — CID 100938634
[(1E,3E)-1,4-bis(4-methoxyphenyl)buta-1,3-dienyl] acetate (PubChem CID 100938634) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is [(1E,3E)-1,4-bis(4-methoxyphenyl)buta-1,3-dienyl] acetate.
| Compound Name | [(1E,3E)-1,4-bis(4-methoxyphenyl)buta-1,3-dienyl] acetate |
|---|---|
| PubChem CID | 100938634 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | [(1E,3E)-1,4-bis(4-methoxyphenyl)buta-1,3-dienyl] acetate |
| SMILES | COc1ccc(/C=C/C=C(/OC(C)=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H20O4/c1-15(21)24-20(17-9-13-19(23-3)14-10-17)6-4-5-16-7-11-18(22-2)12-8-16/h4-14H,1-3H3/b5-4+,20-6+ |
| InChIKey | DYSFMYFCYLCRSE-GERLSISUSA-N |
| XLogP | 4.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|