C21H20ClN3O4 — CID 55700686
(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]prop-2-enamide (PubChem CID 55700686) has the molecular formula C21H20ClN3O4 and a molecular weight of 413.86 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55700686 |
| Molecular Formula | C21H20ClN3O4 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)Nc2ccccc2-c2noc(C)n2)cc(Cl)c1OC |
| InChI | InChI=1S/C21H20ClN3O4/c1-4-28-18-12-14(11-16(22)20(18)27-3)9-10-19(26)24-17-8-6-5-7-15(17)21-23-13(2)29-25-21/h5-12H,4H2,1-3H3,(H,24,26)/b10-9+ |
| InChIKey | GZZBVUMHWGCTOM-MDZDMXLPSA-N |
| XLogP | 4.76 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|