C24H20F4N2O4 — CID 55708144
(E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]prop-2-enamide (PubChem CID 55708144) has the molecular formula C24H20F4N2O4 and a molecular weight of 476.43 g/mol. Its IUPAC name is (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55708144 |
| Molecular Formula | C24H20F4N2O4 |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(OC(F)F)cc1OC(F)F)NCc1ccc(OCc2cccnc2)cc1 |
| InChI | InChI=1S/C24H20F4N2O4/c25-23(26)33-20-9-5-18(21(12-20)34-24(27)28)6-10-22(31)30-14-16-3-7-19(8-4-16)32-15-17-2-1-11-29-13-17/h1-13,23-24H,14-15H2,(H,30,31)/b10-6+ |
| InChIKey | XNYVCBAUPUKKBP-UXBLZVDNSA-N |
| XLogP | 5.19 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|