C13H13F4NO2 — CID 114414934
N-[[2,4-bis(difluoromethoxy)phenyl]methyl]but-3-yn-2-amine (PubChem CID 114414934) has the molecular formula C13H13F4NO2 and a molecular weight of 291.24 g/mol. Its IUPAC name is N-[[2,4-bis(difluoromethoxy)phenyl]methyl]but-3-yn-2-amine.
| Compound Name | N-[[2,4-bis(difluoromethoxy)phenyl]methyl]but-3-yn-2-amine |
|---|---|
| PubChem CID | 114414934 |
| Molecular Formula | C13H13F4NO2 |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | N-[[2,4-bis(difluoromethoxy)phenyl]methyl]but-3-yn-2-amine |
| SMILES | C#CC(C)NCc1ccc(OC(F)F)cc1OC(F)F |
| InChI | InChI=1S/C13H13F4NO2/c1-3-8(2)18-7-9-4-5-10(19-12(14)15)6-11(9)20-13(16)17/h1,4-6,8,12-13,18H,7H2,2H3 |
| InChIKey | MYQSQHDXRWDSDH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|