C10H13F2NO2 — CID 61270001
1-[2-(difluoromethoxy)-4-methoxyphenyl]-N-methylmethanamine (PubChem CID 61270001) has the molecular formula C10H13F2NO2 and a molecular weight of 217.22 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)-4-methoxyphenyl]-N-methylmethanamine.
| Compound Name | 1-[2-(difluoromethoxy)-4-methoxyphenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 61270001 |
| Molecular Formula | C10H13F2NO2 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 1-[2-(difluoromethoxy)-4-methoxyphenyl]-N-methylmethanamine |
| SMILES | CNCc1ccc(OC)cc1OC(F)F |
| InChI | InChI=1S/C10H13F2NO2/c1-13-6-7-3-4-8(14-2)5-9(7)15-10(11)12/h3-5,10,13H,6H2,1-2H3 |
| InChIKey | WTWDPEAFIIQJLJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |