C11H14N2O2 — CID 61268341
2-[5-methoxy-2-(methylaminomethyl)phenoxy]acetonitrile (PubChem CID 61268341) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-[5-methoxy-2-(methylaminomethyl)phenoxy]acetonitrile.
| Compound Name | 2-[5-methoxy-2-(methylaminomethyl)phenoxy]acetonitrile |
|---|---|
| PubChem CID | 61268341 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-[5-methoxy-2-(methylaminomethyl)phenoxy]acetonitrile |
| SMILES | CNCc1ccc(OC)cc1OCC#N |
| InChI | InChI=1S/C11H14N2O2/c1-13-8-9-3-4-10(14-2)7-11(9)15-6-5-12/h3-4,7,13H,6,8H2,1-2H3 |
| InChIKey | QKRWUUOUKTYOSK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |