C13H17NO2 — CID 62311325
1-(2-but-2-ynoxy-5-methoxyphenyl)-N-methylmethanamine (PubChem CID 62311325) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 1-(2-but-2-ynoxy-5-methoxyphenyl)-N-methylmethanamine.
| Compound Name | 1-(2-but-2-ynoxy-5-methoxyphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 62311325 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 1-(2-but-2-ynoxy-5-methoxyphenyl)-N-methylmethanamine |
| SMILES | CC#CCOc1ccc(OC)cc1CNC |
| InChI | InChI=1S/C13H17NO2/c1-4-5-8-16-13-7-6-12(15-3)9-11(13)10-14-2/h6-7,9,14H,8,10H2,1-3H3 |
| InChIKey | PZVGPWHMXIKOLD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|