C13H17F4NO3 — CID 104980379
(2S)-2-[[2,4-bis(difluoromethoxy)phenyl]methylamino]butan-1-ol (PubChem CID 104980379) has the molecular formula C13H17F4NO3 and a molecular weight of 311.27 g/mol. Its IUPAC name is (2S)-2-[[2,4-bis(difluoromethoxy)phenyl]methylamino]butan-1-ol.
| Compound Name | (2S)-2-[[2,4-bis(difluoromethoxy)phenyl]methylamino]butan-1-ol |
|---|---|
| PubChem CID | 104980379 |
| Molecular Formula | C13H17F4NO3 |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (2S)-2-[[2,4-bis(difluoromethoxy)phenyl]methylamino]butan-1-ol |
| SMILES | CC[C@@H](CO)NCc1ccc(OC(F)F)cc1OC(F)F |
| InChI | InChI=1S/C13H17F4NO3/c1-2-9(7-19)18-6-8-3-4-10(20-12(14)15)5-11(8)21-13(16)17/h3-5,9,12-13,18-19H,2,6-7H2,1H3/t9-/m0/s1 |
| InChIKey | OLGUVMHRTWNZDP-VIFPVBQESA-N |
| XLogP | 2.75 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |