C12H15F4NO2S — CID 60658322
N-[[2,4-bis(difluoromethoxy)phenyl]methyl]-2-methylsulfanylethanamine (PubChem CID 60658322) has the molecular formula C12H15F4NO2S and a molecular weight of 313.32 g/mol. Its IUPAC name is N-[[2,4-bis(difluoromethoxy)phenyl]methyl]-2-methylsulfanylethanamine.
| Compound Name | N-[[2,4-bis(difluoromethoxy)phenyl]methyl]-2-methylsulfanylethanamine |
|---|---|
| PubChem CID | 60658322 |
| Molecular Formula | C12H15F4NO2S |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | N-[[2,4-bis(difluoromethoxy)phenyl]methyl]-2-methylsulfanylethanamine |
| SMILES | CSCCNCc1ccc(OC(F)F)cc1OC(F)F |
| InChI | InChI=1S/C12H15F4NO2S/c1-20-5-4-17-7-8-2-3-9(18-11(13)14)6-10(8)19-12(15)16/h2-3,6,11-12,17H,4-5,7H2,1H3 |
| InChIKey | RINBHDGUMDKOOB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|