C13H19F2N3O2 — CID 86781177
3-[[2-(difluoromethoxy)-5-methoxyphenyl]methyl]-1,1,2-trimethylguanidine (PubChem CID 86781177) has the molecular formula C13H19F2N3O2 and a molecular weight of 287.31 g/mol. Its IUPAC name is 3-[[2-(difluoromethoxy)-5-methoxyphenyl]methyl]-1,1,2-trimethylguanidine.
| Compound Name | 3-[[2-(difluoromethoxy)-5-methoxyphenyl]methyl]-1,1,2-trimethylguanidine |
|---|---|
| PubChem CID | 86781177 |
| Molecular Formula | C13H19F2N3O2 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 3-[[2-(difluoromethoxy)-5-methoxyphenyl]methyl]-1,1,2-trimethylguanidine |
| SMILES | C/N=C(/NCc1cc(OC)ccc1OC(F)F)N(C)C |
| InChI | InChI=1S/C13H19F2N3O2/c1-16-13(18(2)3)17-8-9-7-10(19-4)5-6-11(9)20-12(14)15/h5-7,12H,8H2,1-4H3,(H,16,17) |
| InChIKey | QLKCLSJDLGCNSK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|