C11H13F2N3O4 — CID 122094152
4-[[5-(difluoromethoxy)-2-pyridinyl]carbamoylamino]butanoic acid (PubChem CID 122094152) has the molecular formula C11H13F2N3O4 and a molecular weight of 289.24 g/mol. Its IUPAC name is 4-[[5-(difluoromethoxy)-2-pyridinyl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[5-(difluoromethoxy)-2-pyridinyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122094152 |
| Molecular Formula | C11H13F2N3O4 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4-[[5-(difluoromethoxy)-2-pyridinyl]carbamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)Nc1ccc(OC(F)F)cn1 |
| InChI | InChI=1S/C11H13F2N3O4/c12-10(13)20-7-3-4-8(15-6-7)16-11(19)14-5-1-2-9(17)18/h3-4,6,10H,1-2,5H2,(H,17,18)(H2,14,15,16,19) |
| InChIKey | ALCRIBJEQFWBEL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|