C13H16F2N2O4 — CID 122086894
4-[[2-(2,2-difluoroethoxy)phenyl]carbamoylamino]butanoic acid (PubChem CID 122086894) has the molecular formula C13H16F2N2O4 and a molecular weight of 302.28 g/mol. Its IUPAC name is 4-[[2-(2,2-difluoroethoxy)phenyl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[2-(2,2-difluoroethoxy)phenyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122086894 |
| Molecular Formula | C13H16F2N2O4 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 4-[[2-(2,2-difluoroethoxy)phenyl]carbamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)Nc1ccccc1OCC(F)F |
| InChI | InChI=1S/C13H16F2N2O4/c14-11(15)8-21-10-5-2-1-4-9(10)17-13(20)16-7-3-6-12(18)19/h1-2,4-5,11H,3,6-8H2,(H,18,19)(H2,16,17,20) |
| InChIKey | HWYISMMIJLVPBW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|