C14H19N3O4S — CID 122079330
4-[[2-(3-amino-3-oxopropyl)sulfanylphenyl]carbamoylamino]butanoic acid (PubChem CID 122079330) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is 4-[[2-(3-amino-3-oxopropyl)sulfanylphenyl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[2-(3-amino-3-oxopropyl)sulfanylphenyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122079330 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 4-[[2-(3-amino-3-oxopropyl)sulfanylphenyl]carbamoylamino]butanoic acid |
| SMILES | NC(=O)CCSc1ccccc1NC(=O)NCCCC(=O)O |
| InChI | InChI=1S/C14H19N3O4S/c15-12(18)7-9-22-11-5-2-1-4-10(11)17-14(21)16-8-3-6-13(19)20/h1-2,4-5H,3,6-9H2,(H2,15,18)(H,19,20)(H2,16,17,21) |
| InChIKey | LJARGYXESRFGAK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|