C15H17Cl2N3O — CID 51183090
N-(1-cyanocyclohexyl)-2-(3,5-dichloroanilino)acetamide (PubChem CID 51183090) has the molecular formula C15H17Cl2N3O and a molecular weight of 326.23 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-(3,5-dichloroanilino)acetamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-(3,5-dichloroanilino)acetamide |
|---|---|
| PubChem CID | 51183090 |
| Molecular Formula | C15H17Cl2N3O |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-(3,5-dichloroanilino)acetamide |
| SMILES | N#CC1(NC(=O)CNc2cc(Cl)cc(Cl)c2)CCCCC1 |
| InChI | InChI=1S/C15H17Cl2N3O/c16-11-6-12(17)8-13(7-11)19-9-14(21)20-15(10-18)4-2-1-3-5-15/h6-8,19H,1-5,9H2,(H,20,21) |
| InChIKey | XNEQLWPEASQOIO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |