C18H25N3O — CID 32908656
N-(1-cyanocycloheptyl)-2-(2,6-dimethylanilino)acetamide (PubChem CID 32908656) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is N-(1-cyanocycloheptyl)-2-(2,6-dimethylanilino)acetamide.
| Compound Name | N-(1-cyanocycloheptyl)-2-(2,6-dimethylanilino)acetamide |
|---|---|
| PubChem CID | 32908656 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | N-(1-cyanocycloheptyl)-2-(2,6-dimethylanilino)acetamide |
| SMILES | Cc1cccc(C)c1NCC(=O)NC1(C#N)CCCCCC1 |
| InChI | InChI=1S/C18H25N3O/c1-14-8-7-9-15(2)17(14)20-12-16(22)21-18(13-19)10-5-3-4-6-11-18/h7-9,20H,3-6,10-12H2,1-2H3,(H,21,22) |
| InChIKey | NRBTYYPFUWOQSY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |