C17H24N4O2S — CID 126841359
N-(1-cyanocyclohexyl)-2-[2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]anilino]acetamide (PubChem CID 126841359) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-[2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]anilino]acetamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-[2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]anilino]acetamide |
|---|---|
| PubChem CID | 126841359 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-[2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]anilino]acetamide |
| SMILES | CS(C)(=O)=Nc1ccccc1NCC(=O)NC1(C#N)CCCCC1 |
| InChI | InChI=1S/C17H24N4O2S/c1-24(2,23)21-15-9-5-4-8-14(15)19-12-16(22)20-17(13-18)10-6-3-7-11-17/h4-5,8-9,19H,3,6-7,10-12H2,1-2H3,(H,20,22) |
| InChIKey | GFXCLXCMSAPHPB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |