C15H13F2NOS — CID 47152940
3-(2,4-difluorophenyl)sulfanyl-N-phenylpropanamide (PubChem CID 47152940) has the molecular formula C15H13F2NOS and a molecular weight of 293.34 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)sulfanyl-N-phenylpropanamide.
| Compound Name | 3-(2,4-difluorophenyl)sulfanyl-N-phenylpropanamide |
|---|---|
| PubChem CID | 47152940 |
| Molecular Formula | C15H13F2NOS |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3-(2,4-difluorophenyl)sulfanyl-N-phenylpropanamide |
| SMILES | O=C(CCSc1ccc(F)cc1F)Nc1ccccc1 |
| InChI | InChI=1S/C15H13F2NOS/c16-11-6-7-14(13(17)10-11)20-9-8-15(19)18-12-4-2-1-3-5-12/h1-7,10H,8-9H2,(H,18,19) |
| InChIKey | ZLDCNPXRTKFKPB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |