C21H18FN3O2S — CID 60617315
3-[3-(2-fluorophenyl)sulfanylpropanoylamino]-N-pyridin-2-ylbenzamide (PubChem CID 60617315) has the molecular formula C21H18FN3O2S and a molecular weight of 395.46 g/mol. Its IUPAC name is 3-[3-(2-fluorophenyl)sulfanylpropanoylamino]-N-pyridin-2-ylbenzamide.
| Compound Name | 3-[3-(2-fluorophenyl)sulfanylpropanoylamino]-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 60617315 |
| Molecular Formula | C21H18FN3O2S |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 3-[3-(2-fluorophenyl)sulfanylpropanoylamino]-N-pyridin-2-ylbenzamide |
| SMILES | O=C(CCSc1ccccc1F)Nc1cccc(C(=O)Nc2ccccn2)c1 |
| InChI | InChI=1S/C21H18FN3O2S/c22-17-8-1-2-9-18(17)28-13-11-20(26)24-16-7-5-6-15(14-16)21(27)25-19-10-3-4-12-23-19/h1-10,12,14H,11,13H2,(H,24,26)(H,23,25,27) |
| InChIKey | VATYVCIXWRLFSR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |