C26H21N3O3 — CID 60617071
3-[(2-phenoxy-2-phenylacetyl)amino]-N-pyridin-2-ylbenzamide (PubChem CID 60617071) has the molecular formula C26H21N3O3 and a molecular weight of 423.47 g/mol. Its IUPAC name is 3-[(2-phenoxy-2-phenylacetyl)amino]-N-pyridin-2-ylbenzamide.
| Compound Name | 3-[(2-phenoxy-2-phenylacetyl)amino]-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 60617071 |
| Molecular Formula | C26H21N3O3 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 3-[(2-phenoxy-2-phenylacetyl)amino]-N-pyridin-2-ylbenzamide |
| SMILES | O=C(Nc1ccccn1)c1cccc(NC(=O)C(Oc2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C26H21N3O3/c30-25(29-23-16-7-8-17-27-23)20-12-9-13-21(18-20)28-26(31)24(19-10-3-1-4-11-19)32-22-14-5-2-6-15-22/h1-18,24H,(H,28,31)(H,27,29,30) |
| InChIKey | KCYGAVCDLWUMNG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |