C11H13FN2O3S — CID 112550573
N-(2-amino-2-oxoethoxy)-3-(2-fluorophenyl)sulfanylpropanamide (PubChem CID 112550573) has the molecular formula C11H13FN2O3S and a molecular weight of 272.30 g/mol. Its IUPAC name is N-(2-amino-2-oxoethoxy)-3-(2-fluorophenyl)sulfanylpropanamide.
| Compound Name | N-(2-amino-2-oxoethoxy)-3-(2-fluorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 112550573 |
| Molecular Formula | C11H13FN2O3S |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | N-(2-amino-2-oxoethoxy)-3-(2-fluorophenyl)sulfanylpropanamide |
| SMILES | NC(=O)CONC(=O)CCSc1ccccc1F |
| InChI | InChI=1S/C11H13FN2O3S/c12-8-3-1-2-4-9(8)18-6-5-11(16)14-17-7-10(13)15/h1-4H,5-7H2,(H2,13,15)(H,14,16) |
| InChIKey | PXHSKCKLTCTHLA-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|