C16H24N4O4 — CID 119479743
N-(2-aminoethyl)-1-[3-(furan-2-carbonylamino)propanoyl]piperidine-3-carboxamide (PubChem CID 119479743) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[3-(furan-2-carbonylamino)propanoyl]piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-[3-(furan-2-carbonylamino)propanoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119479743 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N-(2-aminoethyl)-1-[3-(furan-2-carbonylamino)propanoyl]piperidine-3-carboxamide |
| SMILES | NCCNC(=O)C1CCCN(C(=O)CCNC(=O)c2ccco2)C1 |
| InChI | InChI=1S/C16H24N4O4/c17-6-8-19-15(22)12-3-1-9-20(11-12)14(21)5-7-18-16(23)13-4-2-10-24-13/h2,4,10,12H,1,3,5-9,11,17H2,(H,18,23)(H,19,22) |
| InChIKey | SGGBNDNLRXAZNC-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |