C17H25N3O4 — CID 55883255
1-butanoyl-N-[2-(furan-2-carbonylamino)ethyl]piperidine-3-carboxamide (PubChem CID 55883255) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 1-butanoyl-N-[2-(furan-2-carbonylamino)ethyl]piperidine-3-carboxamide.
| Compound Name | 1-butanoyl-N-[2-(furan-2-carbonylamino)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55883255 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 1-butanoyl-N-[2-(furan-2-carbonylamino)ethyl]piperidine-3-carboxamide |
| SMILES | CCCC(=O)N1CCCC(C(=O)NCCNC(=O)c2ccco2)C1 |
| InChI | InChI=1S/C17H25N3O4/c1-2-5-15(21)20-10-3-6-13(12-20)16(22)18-8-9-19-17(23)14-7-4-11-24-14/h4,7,11,13H,2-3,5-6,8-10,12H2,1H3,(H,18,22)(H,19,23) |
| InChIKey | OYLUSUIWDSVFHF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|