C19H28N4O4 — CID 119480055
N-(2-aminoethyl)-1-[1-(furan-2-carbonyl)piperidine-2-carbonyl]piperidine-3-carboxamide (PubChem CID 119480055) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[1-(furan-2-carbonyl)piperidine-2-carbonyl]piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-[1-(furan-2-carbonyl)piperidine-2-carbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119480055 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | N-(2-aminoethyl)-1-[1-(furan-2-carbonyl)piperidine-2-carbonyl]piperidine-3-carboxamide |
| SMILES | NCCNC(=O)C1CCCN(C(=O)C2CCCCN2C(=O)c2ccco2)C1 |
| InChI | InChI=1S/C19H28N4O4/c20-8-9-21-17(24)14-5-3-10-22(13-14)18(25)15-6-1-2-11-23(15)19(26)16-7-4-12-27-16/h4,7,12,14-15H,1-3,5-6,8-11,13,20H2,(H,21,24) |
| InChIKey | IACLUSVXHWJGAT-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |