C22H27N3O3 — CID 55973734
(4-benzylpiperazin-1-yl)-[1-(furan-2-carbonyl)piperidin-2-yl]methanone (PubChem CID 55973734) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[1-(furan-2-carbonyl)piperidin-2-yl]methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-[1-(furan-2-carbonyl)piperidin-2-yl]methanone |
|---|---|
| PubChem CID | 55973734 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[1-(furan-2-carbonyl)piperidin-2-yl]methanone |
| SMILES | O=C(C1CCCCN1C(=O)c1ccco1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H27N3O3/c26-21(19-9-4-5-11-25(19)22(27)20-10-6-16-28-20)24-14-12-23(13-15-24)17-18-7-2-1-3-8-18/h1-3,6-8,10,16,19H,4-5,9,11-15,17H2 |
| InChIKey | JCTAGYAMBPSIHO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |