C21H26N4O6 — CID 55981303
1-[2-[4-[1-(furan-2-carbonyl)piperidine-2-carbonyl]piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione (PubChem CID 55981303) has the molecular formula C21H26N4O6 and a molecular weight of 430.46 g/mol. Its IUPAC name is 1-[2-[4-[1-(furan-2-carbonyl)piperidine-2-carbonyl]piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[4-[1-(furan-2-carbonyl)piperidine-2-carbonyl]piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 55981303 |
| Molecular Formula | C21H26N4O6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 1-[2-[4-[1-(furan-2-carbonyl)piperidine-2-carbonyl]piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione |
| SMILES | O=C(CN1C(=O)CCC1=O)N1CCN(C(=O)C2CCCCN2C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C21H26N4O6/c26-17-6-7-18(27)25(17)14-19(28)22-9-11-23(12-10-22)20(29)15-4-1-2-8-24(15)21(30)16-5-3-13-31-16/h3,5,13,15H,1-2,4,6-12,14H2 |
| InChIKey | NUVCVMNFTJLZEG-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 111.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|